C14H16BN3O5 — CID 72548423
2-[(2S)-2-borono-2-[(2-phenylacetyl)amino]ethyl]-4H-imidazole-4-carboxylic acid (PubChem CID 72548423) has the molecular formula C14H16BN3O5 and a molecular weight of 317.11 g/mol. Its IUPAC name is 2-[(2S)-2-borono-2-[(2-phenylacetyl)amino]ethyl]-4H-imidazole-4-carboxylic acid.
| Compound Name | 2-[(2S)-2-borono-2-[(2-phenylacetyl)amino]ethyl]-4H-imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 72548423 |
| Molecular Formula | C14H16BN3O5 |
| Molecular Weight | 317.11 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[(2S)-2-borono-2-[(2-phenylacetyl)amino]ethyl]-4H-imidazole-4-carboxylic acid |
| SMILES | O=C(Cc1ccccc1)N[C@H](CC1=NC(C(=O)O)C=N1)B(O)O |
| InChI | InChI=1S/C14H16BN3O5/c19-13(6-9-4-2-1-3-5-9)18-11(15(22)23)7-12-16-8-10(17-12)14(20)21/h1-5,8,10-11,22-23H,6-7H2,(H,18,19)(H,20,21)/t10?,11-/m1/s1 |
| InChIKey | KQJCWNNTIGFAQR-RRKGBCIJSA-N |
| XLogP | -0.95 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.11 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|