C25H37N3O5S2 — CID 58754213
(2S)-N-[(2S)-4-(ethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanamide (PubChem CID 58754213) has the molecular formula C25H37N3O5S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is (2S)-N-[(2S)-4-(ethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanamide.
| Compound Name | (2S)-N-[(2S)-4-(ethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanamide |
|---|---|
| PubChem CID | 58754213 |
| Molecular Formula | C25H37N3O5S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | (2S)-N-[(2S)-4-(ethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanamide |
| SMILES | CCNC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CCCCC1CCSS1=O)C(C)C |
| InChI | InChI=1S/C25H37N3O5S2/c1-4-26-25(32)23(30)20(16-18-10-6-5-7-11-18)27-24(31)22(17(2)3)28-21(29)13-9-8-12-19-14-15-34-35(19)33/h5-7,10-11,17,19-20,22H,4,8-9,12-16H2,1-3H3,(H,26,32)(H,27,31)(H,28,29)/t19?,20-,22-,35?/m0/s1 |
| InChIKey | CDPBWTDHIAWFCY-XKALJZFCSA-N |
| XLogP | 2.29 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|