C23H31BrN2O6S2 — CID 58754229
(3S)-4-(4-bromophenyl)-3-[[(2S)-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanoyl]amino]-2-oxobutanoic acid (PubChem CID 58754229) has the molecular formula C23H31BrN2O6S2 and a molecular weight of 575.55 g/mol. Its IUPAC name is (3S)-4-(4-bromophenyl)-3-[[(2S)-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanoyl]amino]-2-oxobutanoic acid.
| Compound Name | (3S)-4-(4-bromophenyl)-3-[[(2S)-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanoyl]amino]-2-oxobutanoic acid |
|---|---|
| PubChem CID | 58754229 |
| Molecular Formula | C23H31BrN2O6S2 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | (3S)-4-(4-bromophenyl)-3-[[(2S)-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanoyl]amino]-2-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCC1CCSS1=O)C(=O)N[C@@H](Cc1ccc(Br)cc1)C(=O)C(=O)O |
| InChI | InChI=1S/C23H31BrN2O6S2/c1-14(2)20(26-19(27)6-4-3-5-17-11-12-33-34(17)32)22(29)25-18(21(28)23(30)31)13-15-7-9-16(24)10-8-15/h7-10,14,17-18,20H,3-6,11-13H2,1-2H3,(H,25,29)(H,26,27)(H,30,31)/t17?,18-,20-,34?/m0/s1 |
| InChIKey | SPFDVGDHNJMILJ-FWLACFERSA-N |
| XLogP | 3.00 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|