C26H38ClN3O5S — CID 58754330
(2S)-N-[(2S)-1-(4-chlorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(1-oxothiolan-2-yl)pentanoylamino]butanamide (PubChem CID 58754330) has the molecular formula C26H38ClN3O5S and a molecular weight of 540.13 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(4-chlorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(1-oxothiolan-2-yl)pentanoylamino]butanamide.
| Compound Name | (2S)-N-[(2S)-1-(4-chlorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(1-oxothiolan-2-yl)pentanoylamino]butanamide |
|---|---|
| PubChem CID | 58754330 |
| Molecular Formula | C26H38ClN3O5S |
| Molecular Weight | 540.13 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (2S)-N-[(2S)-1-(4-chlorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(1-oxothiolan-2-yl)pentanoylamino]butanamide |
| SMILES | CCNC(=O)C(=O)[C@H](Cc1ccc(Cl)cc1)NC(=O)[C@@H](NC(=O)CCCCC1CCCS1=O)C(C)C |
| InChI | InChI=1S/C26H38ClN3O5S/c1-4-28-26(34)24(32)21(16-18-11-13-19(27)14-12-18)29-25(33)23(17(2)3)30-22(31)10-6-5-8-20-9-7-15-36(20)35/h11-14,17,20-21,23H,4-10,15-16H2,1-3H3,(H,28,34)(H,29,33)(H,30,31)/t20?,21-,23-,36?/m0/s1 |
| InChIKey | WDDLJLIYCVRPLY-CMEXGESASA-N |
| XLogP | 2.68 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|