C31H40ClN3O7S3 — CID 58754206
(2S)-N-[(2S)-1-(4-chlorophenyl)-4-[(4-methylphenyl)sulfonylmethylamino]-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanamide (PubChem CID 58754206) has the molecular formula C31H40ClN3O7S3 and a molecular weight of 698.33 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(4-chlorophenyl)-4-[(4-methylphenyl)sulfonylmethylamino]-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanamide.
| Compound Name | (2S)-N-[(2S)-1-(4-chlorophenyl)-4-[(4-methylphenyl)sulfonylmethylamino]-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanamide |
|---|---|
| PubChem CID | 58754206 |
| Molecular Formula | C31H40ClN3O7S3 |
| Molecular Weight | 698.33 g/mol |
| Exact Mass | 697.17 |
| IUPAC Name | (2S)-N-[(2S)-1-(4-chlorophenyl)-4-[(4-methylphenyl)sulfonylmethylamino]-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(2-oxodithiolan-3-yl)pentanoylamino]butanamide |
| SMILES | Cc1ccc(S(=O)(=O)CNC(=O)C(=O)[C@H](Cc2ccc(Cl)cc2)NC(=O)[C@@H](NC(=O)CCCCC2CCSS2=O)C(C)C)cc1 |
| InChI | InChI=1S/C31H40ClN3O7S3/c1-20(2)28(35-27(36)7-5-4-6-24-16-17-43-44(24)40)30(38)34-26(18-22-10-12-23(32)13-11-22)29(37)31(39)33-19-45(41,42)25-14-8-21(3)9-15-25/h8-15,20,24,26,28H,4-7,16-19H2,1-3H3,(H,33,39)(H,34,38)(H,35,36)/t24?,26-,28-,44?/m0/s1 |
| InChIKey | JBLOJDGDWFJGNF-FFBHLYPESA-N |
| XLogP | 3.66 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|