C28H40F2N4O6S2 — CID 58754205
(2S)-N-[(2S)-1-(3,4-difluorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-4-methyl-2-[[2-[5-(2-oxodithiolan-3-yl)pentanoylamino]acetyl]amino]pentanamide (PubChem CID 58754205) has the molecular formula C28H40F2N4O6S2 and a molecular weight of 630.78 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(3,4-difluorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-4-methyl-2-[[2-[5-(2-oxodithiolan-3-yl)pentanoylamino]acetyl]amino]pentanamide.
| Compound Name | (2S)-N-[(2S)-1-(3,4-difluorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-4-methyl-2-[[2-[5-(2-oxodithiolan-3-yl)pentanoylamino]acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 58754205 |
| Molecular Formula | C28H40F2N4O6S2 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | (2S)-N-[(2S)-1-(3,4-difluorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-4-methyl-2-[[2-[5-(2-oxodithiolan-3-yl)pentanoylamino]acetyl]amino]pentanamide |
| SMILES | CCNC(=O)C(=O)[C@H](Cc1ccc(F)c(F)c1)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)CCCCC1CCSS1=O |
| InChI | InChI=1S/C28H40F2N4O6S2/c1-4-31-28(39)26(37)22(15-18-9-10-20(29)21(30)14-18)34-27(38)23(13-17(2)3)33-25(36)16-32-24(35)8-6-5-7-19-11-12-41-42(19)40/h9-10,14,17,19,22-23H,4-8,11-13,15-16H2,1-3H3,(H,31,39)(H,32,35)(H,33,36)(H,34,38)/t19?,22-,23-,42?/m0/s1 |
| InChIKey | IZAMUHOWJSDQRE-NJQZHVAXSA-N |
| XLogP | 2.07 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|