C24H33ClN2O5S2 — CID 58754288
(3S)-4-(4-chlorophenyl)-3-[[(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]-4-methylpentanoyl]amino]-2-oxobutanoic acid (PubChem CID 58754288) has the molecular formula C24H33ClN2O5S2 and a molecular weight of 529.12 g/mol. Its IUPAC name is (3S)-4-(4-chlorophenyl)-3-[[(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]-4-methylpentanoyl]amino]-2-oxobutanoic acid.
| Compound Name | (3S)-4-(4-chlorophenyl)-3-[[(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]-4-methylpentanoyl]amino]-2-oxobutanoic acid |
|---|---|
| PubChem CID | 58754288 |
| Molecular Formula | C24H33ClN2O5S2 |
| Molecular Weight | 529.12 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | (3S)-4-(4-chlorophenyl)-3-[[(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]-4-methylpentanoyl]amino]-2-oxobutanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CCCCC1CCSS1)C(=O)N[C@@H](Cc1ccc(Cl)cc1)C(=O)C(=O)O |
| InChI | InChI=1S/C24H33ClN2O5S2/c1-15(2)13-20(26-21(28)6-4-3-5-18-11-12-33-34-18)23(30)27-19(22(29)24(31)32)14-16-7-9-17(25)10-8-16/h7-10,15,18-20H,3-6,11-14H2,1-2H3,(H,26,28)(H,27,30)(H,31,32)/t18?,19-,20-/m0/s1 |
| InChIKey | CERVMQBWCFBEGM-YPJRHXLCSA-N |
| XLogP | 4.27 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.12 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|