C29H43BrN4O5S — CID 58754294
(2S)-N-[(2S)-1-(4-bromophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-4-methyl-2-[[2-[5-(thiolan-2-yl)pentanoylamino]acetyl]amino]pentanamide (PubChem CID 58754294) has the molecular formula C29H43BrN4O5S and a molecular weight of 639.66 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(4-bromophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-4-methyl-2-[[2-[5-(thiolan-2-yl)pentanoylamino]acetyl]amino]pentanamide.
| Compound Name | (2S)-N-[(2S)-1-(4-bromophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-4-methyl-2-[[2-[5-(thiolan-2-yl)pentanoylamino]acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 58754294 |
| Molecular Formula | C29H43BrN4O5S |
| Molecular Weight | 639.66 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | (2S)-N-[(2S)-1-(4-bromophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]-4-methyl-2-[[2-[5-(thiolan-2-yl)pentanoylamino]acetyl]amino]pentanamide |
| SMILES | CCNC(=O)C(=O)[C@H](Cc1ccc(Br)cc1)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)CCCCC1CCCS1 |
| InChI | InChI=1S/C29H43BrN4O5S/c1-4-31-29(39)27(37)23(17-20-11-13-21(30)14-12-20)34-28(38)24(16-19(2)3)33-26(36)18-32-25(35)10-6-5-8-22-9-7-15-40-22/h11-14,19,22-24H,4-10,15-18H2,1-3H3,(H,31,39)(H,32,35)(H,33,36)(H,34,38)/t22?,23-,24-/m0/s1 |
| InChIKey | HIBSCUNURFKROL-VYCPFJESSA-N |
| XLogP | 3.28 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|