C27H41N3O4S — CID 58754338
(2S)-N-[(2S)-4-(ethylamino)-1-(4-methylphenyl)-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(thiolan-2-yl)pentanoylamino]butanamide (PubChem CID 58754338) has the molecular formula C27H41N3O4S and a molecular weight of 503.71 g/mol. Its IUPAC name is (2S)-N-[(2S)-4-(ethylamino)-1-(4-methylphenyl)-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(thiolan-2-yl)pentanoylamino]butanamide.
| Compound Name | (2S)-N-[(2S)-4-(ethylamino)-1-(4-methylphenyl)-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(thiolan-2-yl)pentanoylamino]butanamide |
|---|---|
| PubChem CID | 58754338 |
| Molecular Formula | C27H41N3O4S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (2S)-N-[(2S)-4-(ethylamino)-1-(4-methylphenyl)-3,4-dioxobutan-2-yl]-3-methyl-2-[5-(thiolan-2-yl)pentanoylamino]butanamide |
| SMILES | CCNC(=O)C(=O)[C@H](Cc1ccc(C)cc1)NC(=O)[C@@H](NC(=O)CCCCC1CCCS1)C(C)C |
| InChI | InChI=1S/C27H41N3O4S/c1-5-28-27(34)25(32)22(17-20-14-12-19(4)13-15-20)29-26(33)24(18(2)3)30-23(31)11-7-6-9-21-10-8-16-35-21/h12-15,18,21-22,24H,5-11,16-17H2,1-4H3,(H,28,34)(H,29,33)(H,30,31)/t21?,22-,24-/m0/s1 |
| InChIKey | KLBGJWFBHVGSDH-OVOHSDETSA-N |
| XLogP | 3.32 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|