C28H36ClN3O4 — CID 75020752
4-butyl-N-[1-[[1-(4-chlorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 75020752) has the molecular formula C28H36ClN3O4 and a molecular weight of 514.07 g/mol. Its IUPAC name is 4-butyl-N-[1-[[1-(4-chlorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-butyl-N-[1-[[1-(4-chlorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 75020752 |
| Molecular Formula | C28H36ClN3O4 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 4-butyl-N-[1-[[1-(4-chlorophenyl)-4-(ethylamino)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCCCc1ccc(C(=O)NC(C(=O)NC(Cc2ccc(Cl)cc2)C(=O)C(=O)NCC)C(C)C)cc1 |
| InChI | InChI=1S/C28H36ClN3O4/c1-5-7-8-19-9-13-21(14-10-19)26(34)32-24(18(3)4)27(35)31-23(25(33)28(36)30-6-2)17-20-11-15-22(29)16-12-20/h9-16,18,23-24H,5-8,17H2,1-4H3,(H,30,36)(H,31,35)(H,32,34) |
| InChIKey | IIGNEUVSIFFYBK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|