C35H39ClN4O6 — CID 70344182
9H-fluoren-9-ylmethyl N-[2-[[(2S)-1-[[(Z,2S)-1-(4-chlorophenyl)-3-(ethylcarbamoyl)-4-hydroxybut-3-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamate (PubChem CID 70344182) has the molecular formula C35H39ClN4O6 and a molecular weight of 647.17 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[[(2S)-1-[[(Z,2S)-1-(4-chlorophenyl)-3-(ethylcarbamoyl)-4-hydroxybut-3-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[[(2S)-1-[[(Z,2S)-1-(4-chlorophenyl)-3-(ethylcarbamoyl)-4-hydroxybut-3-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 70344182 |
| Molecular Formula | C35H39ClN4O6 |
| Molecular Weight | 647.17 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[[(2S)-1-[[(Z,2S)-1-(4-chlorophenyl)-3-(ethylcarbamoyl)-4-hydroxybut-3-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CCNC(=O)/C(=C\O)[C@H](Cc1ccc(Cl)cc1)NC(=O)[C@@H](NC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C |
| InChI | InChI=1S/C35H39ClN4O6/c1-4-37-33(43)28(19-41)30(17-22-13-15-23(36)16-14-22)39-34(44)32(21(2)3)40-31(42)18-38-35(45)46-20-29-26-11-7-5-9-24(26)25-10-6-8-12-27(25)29/h5-16,19,21,29-30,32,41H,4,17-18,20H2,1-3H3,(H,37,43)(H,38,45)(H,39,44)(H,40,42)/b28-19-/t30-,32-/m0/s1 |
| InChIKey | DVGZCTNFDZOCCM-RPHOMEABSA-N |
| XLogP | 4.62 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.17 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|