C20H28N2O5 — CID 56836252
methyl 5-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-5-oxopentanoate (PubChem CID 56836252) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is methyl 5-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-5-oxopentanoate.
| Compound Name | methyl 5-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 56836252 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methyl 5-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-5-oxopentanoate |
| SMILES | COC(=O)CCCC(=O)N[C@H](C(=O)NC(C=O)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H28N2O5/c1-14(2)19(22-17(24)10-7-11-18(25)27-3)20(26)21-16(13-23)12-15-8-5-4-6-9-15/h4-6,8-9,13-14,16,19H,7,10-12H2,1-3H3,(H,21,26)(H,22,24)/t16?,19-/m0/s1 |
| InChIKey | PSUJRZWFUOYJHP-CVMIBEPCSA-N |
| XLogP | 1.40 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|