C22H26N2O5 — CID 56836695
phenyl N-[(2S)-1-[[1-(4-methoxyphenyl)-3-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 56836695) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is phenyl N-[(2S)-1-[[1-(4-methoxyphenyl)-3-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | phenyl N-[(2S)-1-[[1-(4-methoxyphenyl)-3-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 56836695 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | phenyl N-[(2S)-1-[[1-(4-methoxyphenyl)-3-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COc1ccc(CC(C=O)NC(=O)[C@@H](NC(=O)Oc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-15(2)20(24-22(27)29-19-7-5-4-6-8-19)21(26)23-17(14-25)13-16-9-11-18(28-3)12-10-16/h4-12,14-15,17,20H,13H2,1-3H3,(H,23,26)(H,24,27)/t17?,20-/m0/s1 |
| InChIKey | WWPIWCRMIDEFRM-OZBJMMHXSA-N |
| XLogP | 2.73 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|