C23H32N2O7 — CID 56836254
dimethyl 2-[4-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-4-oxobutyl]propanedioate (PubChem CID 56836254) has the molecular formula C23H32N2O7 and a molecular weight of 448.52 g/mol. Its IUPAC name is dimethyl 2-[4-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-4-oxobutyl]propanedioate.
| Compound Name | dimethyl 2-[4-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-4-oxobutyl]propanedioate |
|---|---|
| PubChem CID | 56836254 |
| Molecular Formula | C23H32N2O7 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | dimethyl 2-[4-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-4-oxobutyl]propanedioate |
| SMILES | COC(=O)C(CCCC(=O)N[C@H](C(=O)NC(C=O)Cc1ccccc1)C(C)C)C(=O)OC |
| InChI | InChI=1S/C23H32N2O7/c1-15(2)20(21(28)24-17(14-26)13-16-9-6-5-7-10-16)25-19(27)12-8-11-18(22(29)31-3)23(30)32-4/h5-7,9-10,14-15,17-18,20H,8,11-13H2,1-4H3,(H,24,28)(H,25,27)/t17?,20-/m0/s1 |
| InChIKey | IIDUGTGTCIGBNL-OZBJMMHXSA-N |
| XLogP | 1.19 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|