C17H25N3O3 — CID 141392104
(2S,3S)-2-[(2-aminoacetyl)amino]-3-methyl-N-(1-oxo-3-phenylpropan-2-yl)pentanamide (PubChem CID 141392104) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2S,3S)-2-[(2-aminoacetyl)amino]-3-methyl-N-(1-oxo-3-phenylpropan-2-yl)pentanamide.
| Compound Name | (2S,3S)-2-[(2-aminoacetyl)amino]-3-methyl-N-(1-oxo-3-phenylpropan-2-yl)pentanamide |
|---|---|
| PubChem CID | 141392104 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (2S,3S)-2-[(2-aminoacetyl)amino]-3-methyl-N-(1-oxo-3-phenylpropan-2-yl)pentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)CN)C(=O)NC(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H25N3O3/c1-3-12(2)16(20-15(22)10-18)17(23)19-14(11-21)9-13-7-5-4-6-8-13/h4-8,11-12,14,16H,3,9-10,18H2,1-2H3,(H,19,23)(H,20,22)/t12-,14?,16-/m0/s1 |
| InChIKey | SSVHNWQLRBGPEA-PDULFRILSA-N |
| XLogP | 0.40 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|