C30H30N4O3 — CID 59706143
methyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl]amino]-1-oxo-4-phenylbutan-2-yl]methanimidate (PubChem CID 59706143) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl]amino]-1-oxo-4-phenylbutan-2-yl]methanimidate.
| Compound Name | methyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl]amino]-1-oxo-4-phenylbutan-2-yl]methanimidate |
|---|---|
| PubChem CID | 59706143 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | methyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl]amino]-1-oxo-4-phenylbutan-2-yl]methanimidate |
| SMILES | CO/C=N/[C@@H](CCc1ccccc1)C(=O)N[C@H](c1ccccc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C30H30N4O3/c1-37-22-33-27(17-16-23-10-4-2-5-11-23)29(35)34-28(24-12-6-3-7-13-24)30(36,25-14-8-18-31-20-25)26-15-9-19-32-21-26/h2-15,18-22,27-28,36H,16-17H2,1H3,(H,34,35)/b33-22+/t27-,28+/m0/s1 |
| InChIKey | JOKJIYQUSRHUQD-AKQYBKQMSA-N |
| XLogP | 4.25 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|