C22H22FN3O — CID 66962287
2-(cyclobutylamino)-2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol (PubChem CID 66962287) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-(cyclobutylamino)-2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol.
| Compound Name | 2-(cyclobutylamino)-2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol |
|---|---|
| PubChem CID | 66962287 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-(cyclobutylamino)-2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol |
| SMILES | OC(c1cccnc1)(c1cccnc1)C(NC1CCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O/c23-19-10-8-16(9-11-19)21(26-20-6-1-7-20)22(27,17-4-2-12-24-14-17)18-5-3-13-25-15-18/h2-5,8-15,20-21,26-27H,1,6-7H2 |
| InChIKey | BPOGZQLRJMYGIF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |