C12H20N2O2S — CID 115799186
N-ethyl-2-methyl-2-methylsulfonyl-1-pyridin-3-ylpropan-1-amine (PubChem CID 115799186) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N-ethyl-2-methyl-2-methylsulfonyl-1-pyridin-3-ylpropan-1-amine.
| Compound Name | N-ethyl-2-methyl-2-methylsulfonyl-1-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 115799186 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-ethyl-2-methyl-2-methylsulfonyl-1-pyridin-3-ylpropan-1-amine |
| SMILES | CCNC(c1cccnc1)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O2S/c1-5-14-11(10-7-6-8-13-9-10)12(2,3)17(4,15)16/h6-9,11,14H,5H2,1-4H3 |
| InChIKey | ZNZTYYOZHSZLSK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |