C12H20N2O2S — CID 105034585
N,3-dimethyl-3-methylsulfonyl-1-pyridin-3-ylbutan-2-amine (PubChem CID 105034585) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N,3-dimethyl-3-methylsulfonyl-1-pyridin-3-ylbutan-2-amine.
| Compound Name | N,3-dimethyl-3-methylsulfonyl-1-pyridin-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 105034585 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N,3-dimethyl-3-methylsulfonyl-1-pyridin-3-ylbutan-2-amine |
| SMILES | CNC(Cc1cccnc1)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O2S/c1-12(2,17(4,15)16)11(13-3)8-10-6-5-7-14-9-10/h5-7,9,11,13H,8H2,1-4H3 |
| InChIKey | NJKHEWTWIIBWQB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |