C9H12F2N2 — CID 103759818
1,1-difluoro-N-methyl-3-pyridin-3-ylpropan-2-amine (PubChem CID 103759818) has the molecular formula C9H12F2N2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1,1-difluoro-N-methyl-3-pyridin-3-ylpropan-2-amine.
| Compound Name | 1,1-difluoro-N-methyl-3-pyridin-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 103759818 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1,1-difluoro-N-methyl-3-pyridin-3-ylpropan-2-amine |
| SMILES | CNC(Cc1cccnc1)C(F)F |
| InChI | InChI=1S/C9H12F2N2/c1-12-8(9(10)11)5-7-3-2-4-13-6-7/h2-4,6,8-9,12H,5H2,1H3 |
| InChIKey | DNCLJGUTUKZYOA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |