C12H14N2O — CID 63949985
1-(furan-2-yl)-N-methyl-2-pyridin-3-ylethanamine (PubChem CID 63949985) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-(furan-2-yl)-N-methyl-2-pyridin-3-ylethanamine.
| Compound Name | 1-(furan-2-yl)-N-methyl-2-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 63949985 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(furan-2-yl)-N-methyl-2-pyridin-3-ylethanamine |
| SMILES | CNC(Cc1cccnc1)c1ccco1 |
| InChI | InChI=1S/C12H14N2O/c1-13-11(12-5-3-7-15-12)8-10-4-2-6-14-9-10/h2-7,9,11,13H,8H2,1H3 |
| InChIKey | JCFWSVUPBZALQY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |