C11H13N3S — CID 104736641
N-methyl-2-pyridin-3-yl-1-(1,3-thiazol-5-yl)ethanamine (PubChem CID 104736641) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-methyl-2-pyridin-3-yl-1-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | N-methyl-2-pyridin-3-yl-1-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 104736641 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-methyl-2-pyridin-3-yl-1-(1,3-thiazol-5-yl)ethanamine |
| SMILES | CNC(Cc1cccnc1)c1cncs1 |
| InChI | InChI=1S/C11H13N3S/c1-12-10(11-7-14-8-15-11)5-9-3-2-4-13-6-9/h2-4,6-8,10,12H,5H2,1H3 |
| InChIKey | XHJUAEVODGOWHV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |