C23H28N4O4S2 — CID 74432825
benzyl N-[1-[2-(3-methylphenyl)-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate (PubChem CID 74432825) has the molecular formula C23H28N4O4S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is benzyl N-[1-[2-(3-methylphenyl)-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate.
| Compound Name | benzyl N-[1-[2-(3-methylphenyl)-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 74432825 |
| Molecular Formula | C23H28N4O4S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | benzyl N-[1-[2-(3-methylphenyl)-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate |
| SMILES | Cc1cccc(-c2nc(C(CCCCNS(N)(=O)=O)NC(=O)OCc3ccccc3)cs2)c1 |
| InChI | InChI=1S/C23H28N4O4S2/c1-17-8-7-11-19(14-17)22-26-21(16-32-22)20(12-5-6-13-25-33(24,29)30)27-23(28)31-15-18-9-3-2-4-10-18/h2-4,7-11,14,16,20,25H,5-6,12-13,15H2,1H3,(H,27,28)(H2,24,29,30) |
| InChIKey | HERGMWRQJSQSIA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|