C24H26N4O5S — CID 143593021
benzyl N-[(1S)-1-benzo[e][1,3]benzoxazol-2-yl-5-(sulfamoylamino)pentyl]carbamate (PubChem CID 143593021) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is benzyl N-[(1S)-1-benzo[e][1,3]benzoxazol-2-yl-5-(sulfamoylamino)pentyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-benzo[e][1,3]benzoxazol-2-yl-5-(sulfamoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 143593021 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | benzyl N-[(1S)-1-benzo[e][1,3]benzoxazol-2-yl-5-(sulfamoylamino)pentyl]carbamate |
| SMILES | NS(=O)(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)c1nc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C24H26N4O5S/c25-34(30,31)26-15-7-6-12-20(27-24(29)32-16-17-8-2-1-3-9-17)23-28-22-19-11-5-4-10-18(19)13-14-21(22)33-23/h1-5,8-11,13-14,20,26H,6-7,12,15-16H2,(H,27,29)(H2,25,30,31)/t20-/m0/s1 |
| InChIKey | LSHUNHGPGCAFRD-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|