C16H23N5O5S — CID 59028888
benzyl N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(sulfamoylamino)pentyl]carbamate (PubChem CID 59028888) has the molecular formula C16H23N5O5S and a molecular weight of 397.46 g/mol. Its IUPAC name is benzyl N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(sulfamoylamino)pentyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(sulfamoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 59028888 |
| Molecular Formula | C16H23N5O5S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | benzyl N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(sulfamoylamino)pentyl]carbamate |
| SMILES | Cc1noc([C@H](CCCCNS(N)(=O)=O)NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C16H23N5O5S/c1-12-19-15(26-21-12)14(9-5-6-10-18-27(17,23)24)20-16(22)25-11-13-7-3-2-4-8-13/h2-4,7-8,14,18H,5-6,9-11H2,1H3,(H,20,22)(H2,17,23,24)/t14-/m0/s1 |
| InChIKey | YDQLOXHKVSWWDY-AWEZNQCLSA-N |
| XLogP | 1.31 |
| TPSA | 149.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|