C27H29N5O5S — CID 71148025
benzyl N-[(1S)-1-[3-(3-phenylphenyl)-1,2,4-oxadiazol-5-yl]-5-(sulfamoylamino)pentyl]carbamate (PubChem CID 71148025) has the molecular formula C27H29N5O5S and a molecular weight of 535.63 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[3-(3-phenylphenyl)-1,2,4-oxadiazol-5-yl]-5-(sulfamoylamino)pentyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[3-(3-phenylphenyl)-1,2,4-oxadiazol-5-yl]-5-(sulfamoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 71148025 |
| Molecular Formula | C27H29N5O5S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | benzyl N-[(1S)-1-[3-(3-phenylphenyl)-1,2,4-oxadiazol-5-yl]-5-(sulfamoylamino)pentyl]carbamate |
| SMILES | NS(=O)(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)c1nc(-c2cccc(-c3ccccc3)c2)no1 |
| InChI | InChI=1S/C27H29N5O5S/c28-38(34,35)29-17-8-7-16-24(30-27(33)36-19-20-10-3-1-4-11-20)26-31-25(32-37-26)23-15-9-14-22(18-23)21-12-5-2-6-13-21/h1-6,9-15,18,24,29H,7-8,16-17,19H2,(H,30,33)(H2,28,34,35)/t24-/m0/s1 |
| InChIKey | KPMYAIJVPXHJTP-DEOSSOPVSA-N |
| XLogP | 4.33 |
| TPSA | 149.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|