C22H28N6O4S — CID 25217398
benzyl N-[(1S)-1-(1-methyl-5-phenyl-1,2,4-triazol-3-yl)-5-(sulfamoylamino)pentyl]carbamate (PubChem CID 25217398) has the molecular formula C22H28N6O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is benzyl N-[(1S)-1-(1-methyl-5-phenyl-1,2,4-triazol-3-yl)-5-(sulfamoylamino)pentyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-(1-methyl-5-phenyl-1,2,4-triazol-3-yl)-5-(sulfamoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 25217398 |
| Molecular Formula | C22H28N6O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | benzyl N-[(1S)-1-(1-methyl-5-phenyl-1,2,4-triazol-3-yl)-5-(sulfamoylamino)pentyl]carbamate |
| SMILES | Cn1nc([C@H](CCCCNS(N)(=O)=O)NC(=O)OCc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H28N6O4S/c1-28-21(18-12-6-3-7-13-18)26-20(27-28)19(14-8-9-15-24-33(23,30)31)25-22(29)32-16-17-10-4-2-5-11-17/h2-7,10-13,19,24H,8-9,14-16H2,1H3,(H,25,29)(H2,23,30,31)/t19-/m0/s1 |
| InChIKey | QHERGPYYNCCIJX-IBGZPJMESA-N |
| XLogP | 2.41 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|