C20H25N5O4S3 — CID 25217285
benzyl N-[(1S)-1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate (PubChem CID 25217285) has the molecular formula C20H25N5O4S3 and a molecular weight of 495.65 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 25217285 |
| Molecular Formula | C20H25N5O4S3 |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | benzyl N-[(1S)-1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-5-(sulfamoylamino)pentyl]carbamate |
| SMILES | Cc1nc(-c2nc([C@H](CCCCNS(N)(=O)=O)NC(=O)OCc3ccccc3)cs2)cs1 |
| InChI | InChI=1S/C20H25N5O4S3/c1-14-23-18(13-30-14)19-24-17(12-31-19)16(9-5-6-10-22-32(21,27)28)25-20(26)29-11-15-7-3-2-4-8-15/h2-4,7-8,12-13,16,22H,5-6,9-11H2,1H3,(H,25,26)(H2,21,27,28)/t16-/m0/s1 |
| InChIKey | KQIJUGMCFRAVTN-INIZCTEOSA-N |
| XLogP | 3.51 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|