C24H29N3O3S — CID 143593013
benzyl N-[(1S)-1-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-5-(methylamino)pentyl]carbamate (PubChem CID 143593013) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-5-(methylamino)pentyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-5-(methylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 143593013 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | benzyl N-[(1S)-1-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-5-(methylamino)pentyl]carbamate |
| SMILES | CNCCCC[C@H](NC(=O)OCc1ccccc1)c1csc(-c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C24H29N3O3S/c1-25-14-7-6-13-21(27-24(28)30-16-18-9-4-3-5-10-18)22-17-31-23(26-22)19-11-8-12-20(15-19)29-2/h3-5,8-12,15,17,21,25H,6-7,13-14,16H2,1-2H3,(H,27,28)/t21-/m0/s1 |
| InChIKey | MIJQPSYHRYBGMO-NRFANRHFSA-N |
| XLogP | 5.18 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|