C25H25FN4O5S — CID 143180774
(2S)-2-[[2-(4-fluorophenyl)-2-oxoacetyl]amino]-N'-hydroxy-N-(4-phenyl-1,3-thiazol-2-yl)octanediamide (PubChem CID 143180774) has the molecular formula C25H25FN4O5S and a molecular weight of 512.56 g/mol. Its IUPAC name is (2S)-2-[[2-(4-fluorophenyl)-2-oxoacetyl]amino]-N'-hydroxy-N-(4-phenyl-1,3-thiazol-2-yl)octanediamide.
| Compound Name | (2S)-2-[[2-(4-fluorophenyl)-2-oxoacetyl]amino]-N'-hydroxy-N-(4-phenyl-1,3-thiazol-2-yl)octanediamide |
|---|---|
| PubChem CID | 143180774 |
| Molecular Formula | C25H25FN4O5S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (2S)-2-[[2-(4-fluorophenyl)-2-oxoacetyl]amino]-N'-hydroxy-N-(4-phenyl-1,3-thiazol-2-yl)octanediamide |
| SMILES | O=C(CCCCC[C@H](NC(=O)C(=O)c1ccc(F)cc1)C(=O)Nc1nc(-c2ccccc2)cs1)NO |
| InChI | InChI=1S/C25H25FN4O5S/c26-18-13-11-17(12-14-18)22(32)24(34)27-19(9-5-2-6-10-21(31)30-35)23(33)29-25-28-20(15-36-25)16-7-3-1-4-8-16/h1,3-4,7-8,11-15,19,35H,2,5-6,9-10H2,(H,27,34)(H,30,31)(H,28,29,33)/t19-/m0/s1 |
| InChIKey | NVKPXAGFMSUWGZ-IBGZPJMESA-N |
| XLogP | 3.71 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|