C20H17N3O4S — CID 19630523
2-[[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]acetyl]amino]ethyl benzoate (PubChem CID 19630523) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]acetyl]amino]ethyl benzoate.
| Compound Name | 2-[[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]acetyl]amino]ethyl benzoate |
|---|---|
| PubChem CID | 19630523 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]acetyl]amino]ethyl benzoate |
| SMILES | O=C(NCCOC(=O)c1ccccc1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H17N3O4S/c24-17(21-11-12-27-19(26)15-9-5-2-6-10-15)18(25)23-20-22-16(13-28-20)14-7-3-1-4-8-14/h1-10,13H,11-12H2,(H,21,24)(H,22,23,25) |
| InChIKey | QRMIKUHJQARBHD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|