C26H41N9O4S — CID 86577808
(2S)-N-[3-[3-(2-acetamido-1,3-thiazol-4-yl)anilino]-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-oxopropyl]-2,6-diaminohexanamide (PubChem CID 86577808) has the molecular formula C26H41N9O4S and a molecular weight of 575.74 g/mol. Its IUPAC name is (2S)-N-[3-[3-(2-acetamido-1,3-thiazol-4-yl)anilino]-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-oxopropyl]-2,6-diaminohexanamide.
| Compound Name | (2S)-N-[3-[3-(2-acetamido-1,3-thiazol-4-yl)anilino]-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-oxopropyl]-2,6-diaminohexanamide |
|---|---|
| PubChem CID | 86577808 |
| Molecular Formula | C26H41N9O4S |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | (2S)-N-[3-[3-(2-acetamido-1,3-thiazol-4-yl)anilino]-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-oxopropyl]-2,6-diaminohexanamide |
| SMILES | CC(=O)Nc1nc(-c2cccc(NC(=O)C(CNC(=O)[C@@H](N)CCCCN)NC(=O)[C@@H](N)CCCCN)c2)cs1 |
| InChI | InChI=1S/C26H41N9O4S/c1-16(36)32-26-35-22(15-40-26)17-7-6-8-18(13-17)33-25(39)21(34-24(38)20(30)10-3-5-12-28)14-31-23(37)19(29)9-2-4-11-27/h6-8,13,15,19-21H,2-5,9-12,14,27-30H2,1H3,(H,31,37)(H,33,39)(H,34,38)(H,32,35,36)/t19-,20-,21?/m0/s1 |
| InChIKey | KUELULIDUGSXCB-AHTKWCMKSA-N |
| XLogP | 0.22 |
| TPSA | 233.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|