C29H43N7O7S — CID 46935193
[(2R,3S,5R)-5-[[3-(2-acetamido-1,3-thiazol-4-yl)phenyl]carbamoyl]-3-[(2S)-2,6-diaminohexanoyl]oxyoxolan-2-yl]methyl (2S)-2,6-diaminohexanoate (PubChem CID 46935193) has the molecular formula C29H43N7O7S and a molecular weight of 633.77 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[[3-(2-acetamido-1,3-thiazol-4-yl)phenyl]carbamoyl]-3-[(2S)-2,6-diaminohexanoyl]oxyoxolan-2-yl]methyl (2S)-2,6-diaminohexanoate.
| Compound Name | [(2R,3S,5R)-5-[[3-(2-acetamido-1,3-thiazol-4-yl)phenyl]carbamoyl]-3-[(2S)-2,6-diaminohexanoyl]oxyoxolan-2-yl]methyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 46935193 |
| Molecular Formula | C29H43N7O7S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.29 |
| IUPAC Name | [(2R,3S,5R)-5-[[3-(2-acetamido-1,3-thiazol-4-yl)phenyl]carbamoyl]-3-[(2S)-2,6-diaminohexanoyl]oxyoxolan-2-yl]methyl (2S)-2,6-diaminohexanoate |
| SMILES | CC(=O)Nc1nc(-c2cccc(NC(=O)[C@H]3C[C@H](OC(=O)[C@@H](N)CCCCN)[C@@H](COC(=O)[C@@H](N)CCCCN)O3)c2)cs1 |
| InChI | InChI=1S/C29H43N7O7S/c1-17(37)34-29-36-22(16-44-29)18-7-6-8-19(13-18)35-26(38)24-14-23(43-28(40)21(33)10-3-5-12-31)25(42-24)15-41-27(39)20(32)9-2-4-11-30/h6-8,13,16,20-21,23-25H,2-5,9-12,14-15,30-33H2,1H3,(H,35,38)(H,34,36,37)/t20-,21-,23-,24+,25+/m0/s1 |
| InChIKey | FUHVAUCKOWIHKP-LYIXCCSJSA-N |
| XLogP | 1.23 |
| TPSA | 237.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|