C16H10Cl2IN3OS — CID 121080352
1-(3,4-dichlorophenyl)-3-[4-(4-iodophenyl)-1,3-thiazol-2-yl]urea (PubChem CID 121080352) has the molecular formula C16H10Cl2IN3OS and a molecular weight of 490.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-(4-iodophenyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-(4-iodophenyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 121080352 |
| Molecular Formula | C16H10Cl2IN3OS |
| Molecular Weight | 490.15 g/mol |
| Exact Mass | 488.90 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-(4-iodophenyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1nc(-c2ccc(I)cc2)cs1 |
| InChI | InChI=1S/C16H10Cl2IN3OS/c17-12-6-5-11(7-13(12)18)20-15(23)22-16-21-14(8-24-16)9-1-3-10(19)4-2-9/h1-8H,(H2,20,21,22,23) |
| InChIKey | ZGJWJMCTTBCCSQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.15 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|