C18H13F3N2O — CID 72581666
N-(1H-indol-5-yl)-4-(3,3,3-trifluoroprop-1-enyl)benzamide (PubChem CID 72581666) has the molecular formula C18H13F3N2O and a molecular weight of 330.31 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-4-(3,3,3-trifluoroprop-1-enyl)benzamide.
| Compound Name | N-(1H-indol-5-yl)-4-(3,3,3-trifluoroprop-1-enyl)benzamide |
|---|---|
| PubChem CID | 72581666 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(1H-indol-5-yl)-4-(3,3,3-trifluoroprop-1-enyl)benzamide |
| SMILES | O=C(Nc1ccc2[nH]ccc2c1)c1ccc(C=CC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13F3N2O/c19-18(20,21)9-7-12-1-3-13(4-2-12)17(24)23-15-5-6-16-14(11-15)8-10-22-16/h1-11,22H,(H,23,24) |
| InChIKey | GBPHLQHPAAKTEK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |