C16H17N3O4 — CID 71935383
N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-5-nitrofuran-2-carboxamide (PubChem CID 71935383) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 71935383 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-5-nitrofuran-2-carboxamide |
| SMILES | CN1CCCc2cc(CNC(=O)c3ccc([N+](=O)[O-])o3)ccc21 |
| InChI | InChI=1S/C16H17N3O4/c1-18-8-2-3-12-9-11(4-5-13(12)18)10-17-16(20)14-6-7-15(23-14)19(21)22/h4-7,9H,2-3,8,10H2,1H3,(H,17,20) |
| InChIKey | WNQGZHHEUKCHGX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|