C11H17ClN4O4 — CID 119445931
5-nitro-N-(2-piperazin-1-ylethyl)furan-2-carboxamide;hydrochloride (PubChem CID 119445931) has the molecular formula C11H17ClN4O4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 5-nitro-N-(2-piperazin-1-ylethyl)furan-2-carboxamide;hydrochloride.
| Compound Name | 5-nitro-N-(2-piperazin-1-ylethyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119445931 |
| Molecular Formula | C11H17ClN4O4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-nitro-N-(2-piperazin-1-ylethyl)furan-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCNCC1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H16N4O4.ClH/c16-11(9-1-2-10(19-9)15(17)18)13-5-8-14-6-3-12-4-7-14;/h1-2,12H,3-8H2,(H,13,16);1H |
| InChIKey | HGQNVSCBENHHGZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|