C14H21N3O2 — CID 110639588
1,1-diethyl-3-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)urea (PubChem CID 110639588) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1,1-diethyl-3-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)urea.
| Compound Name | 1,1-diethyl-3-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)urea |
|---|---|
| PubChem CID | 110639588 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1,1-diethyl-3-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)urea |
| SMILES | CCN(CC)C(=O)Nc1ccc2c(c1)N(C)CCO2 |
| InChI | InChI=1S/C14H21N3O2/c1-4-17(5-2)14(18)15-11-6-7-13-12(10-11)16(3)8-9-19-13/h6-7,10H,4-5,8-9H2,1-3H3,(H,15,18) |
| InChIKey | ZNHKTDLHHXRKCN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |