C15H21N3O3 — CID 110639935
3-(4-acetyl-2,3-dihydro-1,4-benzoxazin-7-yl)-1,1-diethylurea (PubChem CID 110639935) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-(4-acetyl-2,3-dihydro-1,4-benzoxazin-7-yl)-1,1-diethylurea.
| Compound Name | 3-(4-acetyl-2,3-dihydro-1,4-benzoxazin-7-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 110639935 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-(4-acetyl-2,3-dihydro-1,4-benzoxazin-7-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc2c(c1)OCCN2C(C)=O |
| InChI | InChI=1S/C15H21N3O3/c1-4-17(5-2)15(20)16-12-6-7-13-14(10-12)21-9-8-18(13)11(3)19/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,20) |
| InChIKey | SDYHYFDZTOGJQL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |