C17H16ClN3O3 — CID 110639908
1-(4-acetyl-2,3-dihydro-1,4-benzoxazin-7-yl)-3-(4-chlorophenyl)urea (PubChem CID 110639908) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 1-(4-acetyl-2,3-dihydro-1,4-benzoxazin-7-yl)-3-(4-chlorophenyl)urea.
| Compound Name | 1-(4-acetyl-2,3-dihydro-1,4-benzoxazin-7-yl)-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 110639908 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-(4-acetyl-2,3-dihydro-1,4-benzoxazin-7-yl)-3-(4-chlorophenyl)urea |
| SMILES | CC(=O)N1CCOc2cc(NC(=O)Nc3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C17H16ClN3O3/c1-11(22)21-8-9-24-16-10-14(6-7-15(16)21)20-17(23)19-13-4-2-12(18)3-5-13/h2-7,10H,8-9H2,1H3,(H2,19,20,23) |
| InChIKey | GMWNDXGTZLDKSW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |