C24H19F2NO5 — CID 531419
[4-[2-[(2-fluorobenzoyl)amino]-3-methoxy-3-oxopropyl]phenyl] 2-fluorobenzoate (PubChem CID 531419) has the molecular formula C24H19F2NO5 and a molecular weight of 439.41 g/mol. Its IUPAC name is [4-[2-[(2-fluorobenzoyl)amino]-3-methoxy-3-oxopropyl]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[2-[(2-fluorobenzoyl)amino]-3-methoxy-3-oxopropyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 531419 |
| Molecular Formula | C24H19F2NO5 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [4-[2-[(2-fluorobenzoyl)amino]-3-methoxy-3-oxopropyl]phenyl] 2-fluorobenzoate |
| SMILES | COC(=O)C(Cc1ccc(OC(=O)c2ccccc2F)cc1)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C24H19F2NO5/c1-31-24(30)21(27-22(28)17-6-2-4-8-19(17)25)14-15-10-12-16(13-11-15)32-23(29)18-7-3-5-9-20(18)26/h2-13,21H,14H2,1H3,(H,27,28) |
| InChIKey | ZSMLNQICLIJQEI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|