C26H33N3O6 — CID 118296381
[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-morpholin-4-ylanilino)-3-oxopropyl]phenyl] acetate (PubChem CID 118296381) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-morpholin-4-ylanilino)-3-oxopropyl]phenyl] acetate.
| Compound Name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-morpholin-4-ylanilino)-3-oxopropyl]phenyl] acetate |
|---|---|
| PubChem CID | 118296381 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-morpholin-4-ylanilino)-3-oxopropyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CC(NC(=O)OC(C)(C)C)C(=O)Nc2ccccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H33N3O6/c1-18(30)34-20-11-9-19(10-12-20)17-22(28-25(32)35-26(2,3)4)24(31)27-21-7-5-6-8-23(21)29-13-15-33-16-14-29/h5-12,22H,13-17H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | RYTCKMGXNWNPFC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|