C22H20ClNO3 — CID 22093441
ethyl (2S)-3-(4-chlorophenyl)-2-(naphthalene-1-carbonylamino)propanoate (PubChem CID 22093441) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is ethyl (2S)-3-(4-chlorophenyl)-2-(naphthalene-1-carbonylamino)propanoate.
| Compound Name | ethyl (2S)-3-(4-chlorophenyl)-2-(naphthalene-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 22093441 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | ethyl (2S)-3-(4-chlorophenyl)-2-(naphthalene-1-carbonylamino)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(Cl)cc1)NC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H20ClNO3/c1-2-27-22(26)20(14-15-10-12-17(23)13-11-15)24-21(25)19-9-5-7-16-6-3-4-8-18(16)19/h3-13,20H,2,14H2,1H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | MEXSIXJTJLKJBH-FQEVSTJZSA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |