C20H21Cl2NO4 — CID 6733974
ethyl 3-(4-chlorophenyl)-2-[2-(2-chlorophenyl)ethoxycarbonylamino]propanoate (PubChem CID 6733974) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-2-[2-(2-chlorophenyl)ethoxycarbonylamino]propanoate.
| Compound Name | ethyl 3-(4-chlorophenyl)-2-[2-(2-chlorophenyl)ethoxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 6733974 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-2-[2-(2-chlorophenyl)ethoxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(Cl)cc1)NC(=O)OCCc1ccccc1Cl |
| InChI | InChI=1S/C20H21Cl2NO4/c1-2-26-19(24)18(13-14-7-9-16(21)10-8-14)23-20(25)27-12-11-15-5-3-4-6-17(15)22/h3-10,18H,2,11-13H2,1H3,(H,23,25) |
| InChIKey | MUDGIWQPFCGMIN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |