C20H20ClNO6 — CID 108802284
3-(4-acetyloxyphenyl)-2-[3-(2-chlorophenoxy)propanoylamino]propanoic acid (PubChem CID 108802284) has the molecular formula C20H20ClNO6 and a molecular weight of 405.83 g/mol. Its IUPAC name is 3-(4-acetyloxyphenyl)-2-[3-(2-chlorophenoxy)propanoylamino]propanoic acid.
| Compound Name | 3-(4-acetyloxyphenyl)-2-[3-(2-chlorophenoxy)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 108802284 |
| Molecular Formula | C20H20ClNO6 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-(4-acetyloxyphenyl)-2-[3-(2-chlorophenoxy)propanoylamino]propanoic acid |
| SMILES | CC(=O)Oc1ccc(CC(NC(=O)CCOc2ccccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C20H20ClNO6/c1-13(23)28-15-8-6-14(7-9-15)12-17(20(25)26)22-19(24)10-11-27-18-5-3-2-4-16(18)21/h2-9,17H,10-12H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | VBQWDEZSNFDDLU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|