C19H19NO6 — CID 23218299
2-[[2-(4-acetyloxyphenoxy)acetyl]amino]-3-phenylpropanoic acid (PubChem CID 23218299) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-[[2-(4-acetyloxyphenoxy)acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-(4-acetyloxyphenoxy)acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 23218299 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[[2-(4-acetyloxyphenoxy)acetyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(=O)Oc1ccc(OCC(=O)NC(Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H19NO6/c1-13(21)26-16-9-7-15(8-10-16)25-12-18(22)20-17(19(23)24)11-14-5-3-2-4-6-14/h2-10,17H,11-12H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | FFXGYKVQQWAUDF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|