C22H27NO10S2 — CID 118391030
(2S)-3-[4-[3-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]sulfonylpropylsulfonyloxy]phenyl]-2-methylpropanoic acid (PubChem CID 118391030) has the molecular formula C22H27NO10S2 and a molecular weight of 529.59 g/mol. Its IUPAC name is (2S)-3-[4-[3-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]sulfonylpropylsulfonyloxy]phenyl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[4-[3-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]sulfonylpropylsulfonyloxy]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 118391030 |
| Molecular Formula | C22H27NO10S2 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | (2S)-3-[4-[3-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]sulfonylpropylsulfonyloxy]phenyl]-2-methylpropanoic acid |
| SMILES | C[C@@H](Cc1ccc(OS(=O)(=O)CCCS(=O)(=O)Oc2ccc(C[C@H](N)C(=O)O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H27NO10S2/c1-15(21(24)25)13-16-3-7-18(8-4-16)32-34(28,29)11-2-12-35(30,31)33-19-9-5-17(6-10-19)14-20(23)22(26)27/h3-10,15,20H,2,11-14,23H2,1H3,(H,24,25)(H,26,27)/t15-,20-/m0/s1 |
| InChIKey | PYGWDFXXYFVHHY-YWZLYKJASA-N |
| XLogP | 1.41 |
| TPSA | 187.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|