C19H21Cl2NO4 — CID 160717719
2-amino-3-(4-chlorophenyl)propanoic acid;3-(4-chlorophenyl)-2-methylpropanoic acid (PubChem CID 160717719) has the molecular formula C19H21Cl2NO4 and a molecular weight of 398.29 g/mol. Its IUPAC name is 2-amino-3-(4-chlorophenyl)propanoic acid;3-(4-chlorophenyl)-2-methylpropanoic acid.
| Compound Name | 2-amino-3-(4-chlorophenyl)propanoic acid;3-(4-chlorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 160717719 |
| Molecular Formula | C19H21Cl2NO4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-amino-3-(4-chlorophenyl)propanoic acid;3-(4-chlorophenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(Cl)cc1)C(=O)O.NC(Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C10H11ClO2.C9H10ClNO2/c1-7(10(12)13)6-8-2-4-9(11)5-3-8;10-7-3-1-6(2-4-7)5-8(11)9(12)13/h2-5,7H,6H2,1H3,(H,12,13);1-4,8H,5,11H2,(H,12,13) |
| InChIKey | RSRSCTIRGNDQQN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |