C15H14ClNO2 — CID 70052884
(2S)-2-amino-3-[4-(4-chlorophenyl)phenyl]propanoic acid (PubChem CID 70052884) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(4-chlorophenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(4-chlorophenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70052884 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (2S)-2-amino-3-[4-(4-chlorophenyl)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C15H14ClNO2/c16-13-7-5-12(6-8-13)11-3-1-10(2-4-11)9-14(17)15(18)19/h1-8,14H,9,17H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | YNAJOMWNXOKORZ-AWEZNQCLSA-N |
| XLogP | 2.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |