2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid

C14H21ClN2O4 — CID 22411398

IUPAC2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid
SMILESCC(C)C(N)C(=O)O.NC(Cc1ccc(Cl)cc1)C(=O)O
InChIInChI=1S/C9H10ClNO2.C5H11NO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;1-3(2)4(6)5(7)8/h1-4,8H,5,11H2,(H,12,13);3-4H,6H2,1-2H3,(H,7,8)
InChIKeyOVZLVQZYFBMUDQ-UHFFFAOYSA-N
MW316.79 g/mol
LogP1.35
Rot. Bonds5

About 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid

2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid (PubChem CID 22411398) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid.

Molecular Properties

Compound Name2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid
PubChem CID22411398
Molecular FormulaC14H21ClN2O4
Molecular Weight316.79 g/mol
Exact Mass316.12
IUPAC Name2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid
SMILESCC(C)C(N)C(=O)O.NC(Cc1ccc(Cl)cc1)C(=O)O
InChIInChI=1S/C9H10ClNO2.C5H11NO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;1-3(2)4(6)5(7)8/h1-4,8H,5,11H2,(H,12,13);3-4H,6H2,1-2H3,(H,7,8)
InChIKeyOVZLVQZYFBMUDQ-UHFFFAOYSA-N
XLogP1.35
TPSA126.64 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.79
LogP ≤ 51.35
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid?
The IUPAC name of 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid (CID 22411398) is 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid.
What is the SMILES notation for 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid?
The canonical SMILES for 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid is CC(C)C(N)C(=O)O.NC(Cc1ccc(Cl)cc1)C(=O)O.
What is the InChIKey of 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid?
The InChIKey is OVZLVQZYFBMUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2.C5H11NO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;1-3(2)4(6)5(7)8/h1-4,8H,5,11H2,(H,12,13);3-4H,6H2,1-2H3,(H,7,8).
What are the key properties of 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid?
2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid has a molecular weight of 316.79 g/mol, XLogP of 1.35, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid is sourced from PubChem (CID 22411398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).