C14H21ClN2O4 — CID 22411398
2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid (PubChem CID 22411398) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid.
| Compound Name | 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22411398 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-amino-3-(4-chlorophenyl)propanoic acid;2-amino-3-methylbutanoic acid |
| SMILES | CC(C)C(N)C(=O)O.NC(Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C9H10ClNO2.C5H11NO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;1-3(2)4(6)5(7)8/h1-4,8H,5,11H2,(H,12,13);3-4H,6H2,1-2H3,(H,7,8) |
| InChIKey | OVZLVQZYFBMUDQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |